C24H27Cl2FN4O2 — CID 121238039
3-(3,4-dichlorophenyl)-1-[1-[3-(4-fluorophenyl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]ethyl]-1-methylurea (PubChem CID 121238039) has the molecular formula C24H27Cl2FN4O2 and a molecular weight of 493.41 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[1-[3-(4-fluorophenyl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]ethyl]-1-methylurea.
| Compound Name | 3-(3,4-dichlorophenyl)-1-[1-[3-(4-fluorophenyl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]ethyl]-1-methylurea |
|---|---|
| PubChem CID | 121238039 |
| Molecular Formula | C24H27Cl2FN4O2 |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[1-[3-(4-fluorophenyl)-4-oxo-1,2,4a,5,6,7,8,8a-octahydroquinazolin-2-yl]ethyl]-1-methylurea |
| SMILES | CC(C1NC2CCCCC2C(=O)N1c1ccc(F)cc1)N(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H27Cl2FN4O2/c1-14(30(2)24(33)28-16-9-12-19(25)20(26)13-16)22-29-21-6-4-3-5-18(21)23(32)31(22)17-10-7-15(27)8-11-17/h7-14,18,21-22,29H,3-6H2,1-2H3,(H,28,33) |
| InChIKey | IHDBCXPJJADVQM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |