C25H24N2O4 — CID 121238088
N-[(4-tert-butylphenyl)methyl]-8-imino-4-methyl-2-oxopyrano[2,3-f]chromene-9-carboxamide (PubChem CID 121238088) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-8-imino-4-methyl-2-oxopyrano[2,3-f]chromene-9-carboxamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-8-imino-4-methyl-2-oxopyrano[2,3-f]chromene-9-carboxamide |
|---|---|
| PubChem CID | 121238088 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-8-imino-4-methyl-2-oxopyrano[2,3-f]chromene-9-carboxamide |
| SMILES | [H]/N=c1\oc2ccc3c(C)cc(=O)oc3c2cc1C(=O)NCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-14-11-21(28)31-22-17(14)9-10-20-18(22)12-19(23(26)30-20)24(29)27-13-15-5-7-16(8-6-15)25(2,3)4/h5-12,26H,13H2,1-4H3,(H,27,29)/b26-23- |
| InChIKey | UMTKCFJRDJJORY-RWEWTDSWSA-N |
| XLogP | 4.55 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|