C24H21ClN4O3 — CID 121238430
[3,5-bis(2-methoxyanilino)pyrazol-1-yl]-(3-chlorophenyl)methanone (PubChem CID 121238430) has the molecular formula C24H21ClN4O3 and a molecular weight of 448.91 g/mol. Its IUPAC name is [3,5-bis(2-methoxyanilino)pyrazol-1-yl]-(3-chlorophenyl)methanone.
| Compound Name | [3,5-bis(2-methoxyanilino)pyrazol-1-yl]-(3-chlorophenyl)methanone |
|---|---|
| PubChem CID | 121238430 |
| Molecular Formula | C24H21ClN4O3 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | [3,5-bis(2-methoxyanilino)pyrazol-1-yl]-(3-chlorophenyl)methanone |
| SMILES | COc1ccccc1Nc1cc(Nc2ccccc2OC)n(C(=O)c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C24H21ClN4O3/c1-31-20-12-5-3-10-18(20)26-22-15-23(27-19-11-4-6-13-21(19)32-2)29(28-22)24(30)16-8-7-9-17(25)14-16/h3-15,27H,1-2H3,(H,26,28) |
| InChIKey | YSTRLJSEHRNIAE-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 77.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |