C16H22N2O3S — CID 121239064
N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-methoxyindol-1-yl)acetamide (PubChem CID 121239064) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-methoxyindol-1-yl)acetamide.
| Compound Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-methoxyindol-1-yl)acetamide |
|---|---|
| PubChem CID | 121239064 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | N-(1-hydroxy-4-methylsulfanylbutan-2-yl)-2-(4-methoxyindol-1-yl)acetamide |
| SMILES | COc1cccc2c1ccn2CC(=O)NC(CO)CCSC |
| InChI | InChI=1S/C16H22N2O3S/c1-21-15-5-3-4-14-13(15)6-8-18(14)10-16(20)17-12(11-19)7-9-22-2/h3-6,8,12,19H,7,9-11H2,1-2H3,(H,17,20) |
| InChIKey | FICYICKTVKSASP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |