C20H24N2O7 — CID 121239188
5-[(4-hydroxy-3-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 121239188) has the molecular formula C20H24N2O7 and a molecular weight of 404.42 g/mol. Its IUPAC name is 5-[(4-hydroxy-3-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(4-hydroxy-3-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 121239188 |
| Molecular Formula | C20H24N2O7 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 5-[(4-hydroxy-3-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | COc1cc(C(c2n(C)c(C)c(C)[n+]2[O-])C2C(=O)OC(C)(C)OC2=O)ccc1O |
| InChI | InChI=1S/C20H24N2O7/c1-10-11(2)22(26)17(21(10)5)15(12-7-8-13(23)14(9-12)27-6)16-18(24)28-20(3,4)29-19(16)25/h7-9,15-16,23H,1-6H3 |
| InChIKey | VWMFOIFWXKIXHF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|