C19H24N4OS — CID 121239448
4-methylsulfanyl-N-(2-propan-2-yl-3H-benzimidazol-5-yl)-2-pyrrol-1-ylbutanamide (PubChem CID 121239448) has the molecular formula C19H24N4OS and a molecular weight of 356.50 g/mol. Its IUPAC name is 4-methylsulfanyl-N-(2-propan-2-yl-3H-benzimidazol-5-yl)-2-pyrrol-1-ylbutanamide.
| Compound Name | 4-methylsulfanyl-N-(2-propan-2-yl-3H-benzimidazol-5-yl)-2-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 121239448 |
| Molecular Formula | C19H24N4OS |
| Molecular Weight | 356.50 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-methylsulfanyl-N-(2-propan-2-yl-3H-benzimidazol-5-yl)-2-pyrrol-1-ylbutanamide |
| SMILES | CSCCC(C(=O)Nc1ccc2nc(C(C)C)[nH]c2c1)n1cccc1 |
| InChI | InChI=1S/C19H24N4OS/c1-13(2)18-21-15-7-6-14(12-16(15)22-18)20-19(24)17(8-11-25-3)23-9-4-5-10-23/h4-7,9-10,12-13,17H,8,11H2,1-3H3,(H,20,24)(H,21,22) |
| InChIKey | UEHJARDTTJLBEI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |