C20H29N3O3 — CID 121239933
N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[1-(2-methoxyethyl)indol-4-yl]oxyacetamide (PubChem CID 121239933) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[1-(2-methoxyethyl)indol-4-yl]oxyacetamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[1-(2-methoxyethyl)indol-4-yl]oxyacetamide |
|---|---|
| PubChem CID | 121239933 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[1-(2-methoxyethyl)indol-4-yl]oxyacetamide |
| SMILES | CCN1CCCC1CNC(=O)COc1cccc2c1ccn2CCOC |
| InChI | InChI=1S/C20H29N3O3/c1-3-22-10-5-6-16(22)14-21-20(24)15-26-19-8-4-7-18-17(19)9-11-23(18)12-13-25-2/h4,7-9,11,16H,3,5-6,10,12-15H2,1-2H3,(H,21,24) |
| InChIKey | DOBKVFCQQFDYQJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |