C25H24ClFN4O4 — CID 121240105
5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3-chloro-4-fluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 121240105) has the molecular formula C25H24ClFN4O4 and a molecular weight of 498.94 g/mol. Its IUPAC name is 5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3-chloro-4-fluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3-chloro-4-fluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 121240105 |
| Molecular Formula | C25H24ClFN4O4 |
| Molecular Weight | 498.94 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | 5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-(3-chloro-4-fluorophenyl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(C)[n+]([O-])c(C(c2ccc(F)c(Cl)c2)C2C(=O)N(C)C(=O)N(C)C2=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C25H24ClFN4O4/c1-14-15(2)31(35)22(30(14)13-16-8-6-5-7-9-16)20(17-10-11-19(27)18(26)12-17)21-23(32)28(3)25(34)29(4)24(21)33/h5-12,20-21H,13H2,1-4H3 |
| InChIKey | LNXGDQYSHGAXKV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 89.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|