C16H17N3O3 — CID 121240186
methyl 5-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-oxo-2H-pyrazolo[4,3-c]pyridine-7-carboxylate (PubChem CID 121240186) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl 5-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-oxo-2H-pyrazolo[4,3-c]pyridine-7-carboxylate.
| Compound Name | methyl 5-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-oxo-2H-pyrazolo[4,3-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 121240186 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl 5-(2-bicyclo[2.2.1]hept-5-enylmethyl)-3-oxo-2H-pyrazolo[4,3-c]pyridine-7-carboxylate |
| SMILES | COC(=O)c1cn(CC2CC3C=CC2C3)cc2c(=O)[nH]nc1-2 |
| InChI | InChI=1S/C16H17N3O3/c1-22-16(21)13-8-19(7-12-14(13)17-18-15(12)20)6-11-5-9-2-3-10(11)4-9/h2-3,7-11H,4-6H2,1H3,(H,18,20) |
| InChIKey | YHXLFRUBEXDYMC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|