C21H27N3OS — CID 121240638
N-[1-(2-methylpropyl)indol-4-yl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide (PubChem CID 121240638) has the molecular formula C21H27N3OS and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[1-(2-methylpropyl)indol-4-yl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide.
| Compound Name | N-[1-(2-methylpropyl)indol-4-yl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide |
|---|---|
| PubChem CID | 121240638 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[1-(2-methylpropyl)indol-4-yl]-4-methylsulfanyl-2-pyrrol-1-ylbutanamide |
| SMILES | CSCCC(C(=O)Nc1cccc2c1ccn2CC(C)C)n1cccc1 |
| InChI | InChI=1S/C21H27N3OS/c1-16(2)15-24-13-9-17-18(7-6-8-19(17)24)22-21(25)20(10-14-26-3)23-11-4-5-12-23/h4-9,11-13,16,20H,10,14-15H2,1-3H3,(H,22,25) |
| InChIKey | QXWTUVNHTQQMET-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |