C9H8F9N — CID 121241192
1-(1,2,2-trifluoroethenyl)-3,5-bis(trifluoromethyl)piperidine (PubChem CID 121241192) has the molecular formula C9H8F9N and a molecular weight of 301.15 g/mol. Its IUPAC name is 1-(1,2,2-trifluoroethenyl)-3,5-bis(trifluoromethyl)piperidine.
| Compound Name | 1-(1,2,2-trifluoroethenyl)-3,5-bis(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 121241192 |
| Molecular Formula | C9H8F9N |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | 1-(1,2,2-trifluoroethenyl)-3,5-bis(trifluoromethyl)piperidine |
| SMILES | FC(F)=C(F)N1CC(C(F)(F)F)CC(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H8F9N/c10-6(11)7(12)19-2-4(8(13,14)15)1-5(3-19)9(16,17)18/h4-5H,1-3H2 |
| InChIKey | TYUFHPDAGFDWRR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|