About 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium
2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium (PubChem CID 121242027) has the molecular formula C22H24N5+
and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium.
Molecular Properties
| Compound Name | 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium |
| PubChem CID | 121242027 |
| Molecular Formula | C22H24N5+ |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium |
| SMILES | Cc1c2cc[n+](CCCCCN=[N+]=[N-])cc2c(C)c2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C22H23N5/c1-15-19-14-27(12-7-3-6-11-24-26-23)13-10-17(19)16(2)22-21(15)18-8-4-5-9-20(18)25-22/h4-5,8-10,13-14H,3,6-7,11-12H2,1-2H3/p+1 |
| InChIKey | AVVOZHPFCYZSQB-UHFFFAOYSA-O |
| XLogP | 5.86 |
| TPSA | 68.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium?
The IUPAC name of 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium (CID 121242027) is 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium.
What is the SMILES notation for 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium?
The canonical SMILES for 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium is Cc1c2cc[n+](CCCCCN=[N+]=[N-])cc2c(C)c2c1[nH]c1ccccc12.
What is the InChIKey of 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium?
The InChIKey is AVVOZHPFCYZSQB-UHFFFAOYSA-O. The full InChI is InChI=1S/C22H23N5/c1-15-19-14-27(12-7-3-6-11-24-26-23)13-10-17(19)16(2)22-21(15)18-8-4-5-9-20(18)25-22/h4-5,8-10,13-14H,3,6-7,11-12H2,1-2H3/p+1.
What are the key properties of 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium?
2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium has a molecular weight of 358.47 g/mol, XLogP of 5.86, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-azidopentyl)-5,11-dimethyl-6H-pyrido[4,3-b]carbazol-2-ium is sourced from PubChem (CID 121242027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).