About 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one
4-bromo-4,4a-dihydrobenzo[c]chromen-6-one (PubChem CID 121242493) has the molecular formula C13H9BrO2
and a molecular weight of 277.12 g/mol. Its IUPAC name is 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one.
Molecular Properties
| Compound Name | 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one |
| PubChem CID | 121242493 |
| Molecular Formula | C13H9BrO2 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 275.98 |
| IUPAC Name | 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one |
| SMILES | O=C1OC2C(=CC=CC2Br)c2ccccc21 |
| InChI | InChI=1S/C13H9BrO2/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)16-12(9)11/h1-7,11-12H |
| InChIKey | LPFFYZWZKVLRCZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one?
The IUPAC name of 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one (CID 121242493) is 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one.
What is the SMILES notation for 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one?
The canonical SMILES for 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one is O=C1OC2C(=CC=CC2Br)c2ccccc21.
What is the InChIKey of 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one?
The InChIKey is LPFFYZWZKVLRCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrO2/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)16-12(9)11/h1-7,11-12H.
What are the key properties of 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one?
4-bromo-4,4a-dihydrobenzo[c]chromen-6-one has a molecular weight of 277.12 g/mol, XLogP of 2.94, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-4,4a-dihydrobenzo[c]chromen-6-one is sourced from PubChem (CID 121242493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).