C26H42N2S2 — CID 121242524
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-aminoethyldisulfanyl)ethyl]docosa-1,4,7,10,13,16,19-heptaen-2-amine (PubChem CID 121242524) has the molecular formula C26H42N2S2 and a molecular weight of 446.77 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-aminoethyldisulfanyl)ethyl]docosa-1,4,7,10,13,16,19-heptaen-2-amine.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-aminoethyldisulfanyl)ethyl]docosa-1,4,7,10,13,16,19-heptaen-2-amine |
|---|---|
| PubChem CID | 121242524 |
| Molecular Formula | C26H42N2S2 |
| Molecular Weight | 446.77 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-aminoethyldisulfanyl)ethyl]docosa-1,4,7,10,13,16,19-heptaen-2-amine |
| SMILES | C=C(C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)NCCSSCCN |
| InChI | InChI=1S/C26H42N2S2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(2)28-23-25-30-29-24-22-27/h4-5,7-8,10-11,13-14,16-17,19-20,28H,2-3,6,9,12,15,18,21-25,27H2,1H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | PZJYKKWRDKZHGJ-JDPCYWKWSA-N |
| XLogP | 7.52 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.77 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|