C25H46N2O4 — CID 121244450
1-O-[2,6-di(propan-2-yl)piperidin-4-yl] 3-O-(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) propanedioate (PubChem CID 121244450) has the molecular formula C25H46N2O4 and a molecular weight of 438.65 g/mol. Its IUPAC name is 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] 3-O-(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) propanedioate.
| Compound Name | 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] 3-O-(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) propanedioate |
|---|---|
| PubChem CID | 121244450 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] 3-O-(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) propanedioate |
| SMILES | CC(C)C1CC(OC(=O)CC(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)CC(C(C)C)N1 |
| InChI | InChI=1S/C25H46N2O4/c1-15(2)20-10-18(11-21(26-20)16(3)4)30-22(28)12-23(29)31-19-13-24(7,8)27-25(9,14-19)17(5)6/h15-21,26-27H,10-14H2,1-9H3 |
| InChIKey | PXPGOEBXHCJRCE-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|