About bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate
bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate (PubChem CID 121244479) has the molecular formula C26H48N2O4
and a molecular weight of 452.68 g/mol. Its IUPAC name is bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate.
Molecular Properties
| Compound Name | bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate |
| PubChem CID | 121244479 |
| Molecular Formula | C26H48N2O4 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.36 |
| IUPAC Name | bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate |
| SMILES | CC(C)C1CC(OC(=O)CCC(=O)OC2CC(C(C)C)NC(C(C)C)C2)CC(C(C)C)N1 |
| InChI | InChI=1S/C26H48N2O4/c1-15(2)21-11-19(12-22(27-21)16(3)4)31-25(29)9-10-26(30)32-20-13-23(17(5)6)28-24(14-20)18(7)8/h15-24,27-28H,9-14H2,1-8H3 |
| InChIKey | MQEXFTUCPPRDIC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
The IUPAC name of bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate (CID 121244479) is bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate.
What is the SMILES notation for bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
The canonical SMILES for bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate is CC(C)C1CC(OC(=O)CCC(=O)OC2CC(C(C)C)NC(C(C)C)C2)CC(C(C)C)N1.
What is the InChIKey of bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
The InChIKey is MQEXFTUCPPRDIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H48N2O4/c1-15(2)21-11-19(12-22(27-21)16(3)4)31-25(29)9-10-26(30)32-20-13-23(17(5)6)28-24(14-20)18(7)8/h15-24,27-28H,9-14H2,1-8H3.
What are the key properties of bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate has a molecular weight of 452.68 g/mol, XLogP of 4.46, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate is sourced from PubChem (CID 121244479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).