About 4-ethoxy-2,6-di(propan-2-yl)piperidine
4-ethoxy-2,6-di(propan-2-yl)piperidine (PubChem CID 121244488) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 4-ethoxy-2,6-di(propan-2-yl)piperidine.
Molecular Properties
| Compound Name | 4-ethoxy-2,6-di(propan-2-yl)piperidine |
| PubChem CID | 121244488 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 4-ethoxy-2,6-di(propan-2-yl)piperidine |
| SMILES | CCOC1CC(C(C)C)NC(C(C)C)C1 |
| InChI | InChI=1S/C13H27NO/c1-6-15-11-7-12(9(2)3)14-13(8-11)10(4)5/h9-14H,6-8H2,1-5H3 |
| InChIKey | SCOPCMYXYONCTL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethoxy-2,6-di(propan-2-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxy-2,6-di(propan-2-yl)piperidine?
The IUPAC name of 4-ethoxy-2,6-di(propan-2-yl)piperidine (CID 121244488) is 4-ethoxy-2,6-di(propan-2-yl)piperidine.
What is the SMILES notation for 4-ethoxy-2,6-di(propan-2-yl)piperidine?
The canonical SMILES for 4-ethoxy-2,6-di(propan-2-yl)piperidine is CCOC1CC(C(C)C)NC(C(C)C)C1.
What is the InChIKey of 4-ethoxy-2,6-di(propan-2-yl)piperidine?
The InChIKey is SCOPCMYXYONCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-6-15-11-7-12(9(2)3)14-13(8-11)10(4)5/h9-14H,6-8H2,1-5H3.
What are the key properties of 4-ethoxy-2,6-di(propan-2-yl)piperidine?
4-ethoxy-2,6-di(propan-2-yl)piperidine has a molecular weight of 213.36 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxy-2,6-di(propan-2-yl)piperidine is sourced from PubChem (CID 121244488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).