About N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine
N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine (PubChem CID 121244500) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine |
| PubChem CID | 121244500 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine |
| SMILES | CCNC1CC(C(C)C)NC(C)(C)C1 |
| InChI | InChI=1S/C12H26N2/c1-6-13-10-7-11(9(2)3)14-12(4,5)8-10/h9-11,13-14H,6-8H2,1-5H3 |
| InChIKey | YSJJZSWSISUNTN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine?
The IUPAC name of N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine (CID 121244500) is N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine.
What is the SMILES notation for N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine?
The canonical SMILES for N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine is CCNC1CC(C(C)C)NC(C)(C)C1.
What is the InChIKey of N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine?
The InChIKey is YSJJZSWSISUNTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2/c1-6-13-10-7-11(9(2)3)14-12(4,5)8-10/h9-11,13-14H,6-8H2,1-5H3.
What are the key properties of N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine?
N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine has a molecular weight of 198.35 g/mol, XLogP of 2.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,2-dimethyl-6-propan-2-ylpiperidin-4-amine is sourced from PubChem (CID 121244500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).