About 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate
4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate (PubChem CID 121244510) has the molecular formula C25H46N2O4
and a molecular weight of 438.65 g/mol. Its IUPAC name is 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate.
Molecular Properties
| Compound Name | 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate |
| PubChem CID | 121244510 |
| Molecular Formula | C25H46N2O4 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.35 |
| IUPAC Name | 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate |
| SMILES | CC(C)C1CC(OC(=O)CCC(=O)OC2CC(C(C)C)NC(C)(C)C2)CC(C(C)C)N1 |
| InChI | InChI=1S/C25H46N2O4/c1-15(2)20-11-18(12-21(26-20)16(3)4)30-23(28)9-10-24(29)31-19-13-22(17(5)6)27-25(7,8)14-19/h15-22,26-27H,9-14H2,1-8H3 |
| InChIKey | WXEVIYJPJKBQIL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
The IUPAC name of 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate (CID 121244510) is 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate.
What is the SMILES notation for 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
The canonical SMILES for 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate is CC(C)C1CC(OC(=O)CCC(=O)OC2CC(C(C)C)NC(C)(C)C2)CC(C(C)C)N1.
What is the InChIKey of 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
The InChIKey is WXEVIYJPJKBQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H46N2O4/c1-15(2)20-11-18(12-21(26-20)16(3)4)30-23(28)9-10-24(29)31-19-13-22(17(5)6)27-25(7,8)14-19/h15-22,26-27H,9-14H2,1-8H3.
What are the key properties of 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate?
4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate has a molecular weight of 438.65 g/mol, XLogP of 4.21, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2,2-dimethyl-6-propan-2-ylpiperidin-4-yl) 1-O-[2,6-di(propan-2-yl)piperidin-4-yl] butanedioate is sourced from PubChem (CID 121244510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).