C35H69N3O3 — CID 121244682
4-[1,2-bis[[2,6-di(propan-2-yl)piperidin-4-yl]oxy]ethoxy]-2,6-di(propan-2-yl)piperidine (PubChem CID 121244682) has the molecular formula C35H69N3O3 and a molecular weight of 579.96 g/mol. Its IUPAC name is 4-[1,2-bis[[2,6-di(propan-2-yl)piperidin-4-yl]oxy]ethoxy]-2,6-di(propan-2-yl)piperidine.
| Compound Name | 4-[1,2-bis[[2,6-di(propan-2-yl)piperidin-4-yl]oxy]ethoxy]-2,6-di(propan-2-yl)piperidine |
|---|---|
| PubChem CID | 121244682 |
| Molecular Formula | C35H69N3O3 |
| Molecular Weight | 579.96 g/mol |
| Exact Mass | 579.53 |
| IUPAC Name | 4-[1,2-bis[[2,6-di(propan-2-yl)piperidin-4-yl]oxy]ethoxy]-2,6-di(propan-2-yl)piperidine |
| SMILES | CC(C)C1CC(OCC(OC2CC(C(C)C)NC(C(C)C)C2)OC2CC(C(C)C)NC(C(C)C)C2)CC(C(C)C)N1 |
| InChI | InChI=1S/C35H69N3O3/c1-20(2)29-13-26(14-30(36-29)21(3)4)39-19-35(40-27-15-31(22(5)6)37-32(16-27)23(7)8)41-28-17-33(24(9)10)38-34(18-28)25(11)12/h20-38H,13-19H2,1-12H3 |
| InChIKey | OOQAKVOUDRXWSE-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.96 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|