C63H93N3O6 — CID 121244701
4-[3,5-bis[[2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidin-4-yl]oxy]phenoxy]-2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidine (PubChem CID 121244701) has the molecular formula C63H93N3O6 and a molecular weight of 988.45 g/mol. Its IUPAC name is 4-[3,5-bis[[2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidin-4-yl]oxy]phenoxy]-2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidine.
| Compound Name | 4-[3,5-bis[[2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidin-4-yl]oxy]phenoxy]-2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 121244701 |
| Molecular Formula | C63H93N3O6 |
| Molecular Weight | 988.45 g/mol |
| Exact Mass | 987.71 |
| IUPAC Name | 4-[3,5-bis[[2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidin-4-yl]oxy]phenoxy]-2,2,6-trimethyl-1-(1-phenylethoxy)-6-propan-2-ylpiperidine |
| SMILES | CC(ON1C(C)(C)CC(Oc2cc(OC3CC(C)(C)N(OC(C)c4ccccc4)C(C)(C(C)C)C3)cc(OC3CC(C)(C)N(OC(C)c4ccccc4)C(C)(C(C)C)C3)c2)CC1(C)C(C)C)c1ccccc1 |
| InChI | InChI=1S/C63H93N3O6/c1-43(2)61(16)40-55(37-58(10,11)64(61)70-46(7)49-28-22-19-23-29-49)67-52-34-53(68-56-38-59(12,13)65(62(17,41-56)44(3)4)71-47(8)50-30-24-20-25-31-50)36-54(35-52)69-57-39-60(14,15)66(63(18,42-57)45(5)6)72-48(9)51-32-26-21-27-33-51/h19-36,43-48,55-57H,37-42H2,1-18H3 |
| InChIKey | UKUNQORCMUFCCH-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 988.45 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |