C14H23FO4 — CID 121245831
(3aR,5R,6S,6aS)-5-(butoxymethyl)-5-ethenyl-6-fluoro-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 121245831) has the molecular formula C14H23FO4 and a molecular weight of 274.33 g/mol. Its IUPAC name is (3aR,5R,6S,6aS)-5-(butoxymethyl)-5-ethenyl-6-fluoro-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aS)-5-(butoxymethyl)-5-ethenyl-6-fluoro-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 121245831 |
| Molecular Formula | C14H23FO4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (3aR,5R,6S,6aS)-5-(butoxymethyl)-5-ethenyl-6-fluoro-2,2-dimethyl-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | C=C[C@]1(COCCCC)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1F |
| InChI | InChI=1S/C14H23FO4/c1-5-7-8-16-9-14(6-2)11(15)10-12(19-14)18-13(3,4)17-10/h6,10-12H,2,5,7-9H2,1,3-4H3/t10-,11+,12+,14-/m1/s1 |
| InChIKey | ZZJPXYOQCJIRMW-OWTLIXCDSA-N |
| XLogP | 2.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|