C38H40N2S3 — CID 121246431
4,7-bis[5-[2,6-di(propan-2-yl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole (PubChem CID 121246431) has the molecular formula C38H40N2S3 and a molecular weight of 620.95 g/mol. Its IUPAC name is 4,7-bis[5-[2,6-di(propan-2-yl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole.
| Compound Name | 4,7-bis[5-[2,6-di(propan-2-yl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 121246431 |
| Molecular Formula | C38H40N2S3 |
| Molecular Weight | 620.95 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | 4,7-bis[5-[2,6-di(propan-2-yl)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazole |
| SMILES | CC(C)c1cccc(C(C)C)c1-c1ccc(-c2ccc(-c3ccc(-c4c(C(C)C)cccc4C(C)C)s3)c3nsnc23)s1 |
| InChI | InChI=1S/C38H40N2S3/c1-21(2)25-11-9-12-26(22(3)4)35(25)33-19-17-31(41-33)29-15-16-30(38-37(29)39-43-40-38)32-18-20-34(42-32)36-27(23(5)6)13-10-14-28(36)24(7)8/h9-24H,1-8H3 |
| InChIKey | YTWWFNVADKHJAQ-UHFFFAOYSA-N |
| XLogP | 12.98 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.95 |
| LogP ≤ 5 | 12.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |