About [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite
[(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite (PubChem CID 121246761) has the molecular formula C8H12F2INO3
and a molecular weight of 335.09 g/mol. Its IUPAC name is [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite.
Molecular Properties
| Compound Name | [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite |
| PubChem CID | 121246761 |
| Molecular Formula | C8H12F2INO3 |
| Molecular Weight | 335.09 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite |
| SMILES | O=C(CCO)N1CC[C@H](OI)C(F)(F)C1 |
| InChI | InChI=1S/C8H12F2INO3/c9-8(10)5-12(7(14)2-4-13)3-1-6(8)15-11/h6,13H,1-5H2/t6-/m0/s1 |
| InChIKey | UXAYCFGAEYZSFV-LURJTMIESA-N |
| XLogP | 0.97 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.09 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite?
The IUPAC name of [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite (CID 121246761) is [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite.
What is the SMILES notation for [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite?
The canonical SMILES for [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite is O=C(CCO)N1CC[C@H](OI)C(F)(F)C1.
What is the InChIKey of [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite?
The InChIKey is UXAYCFGAEYZSFV-LURJTMIESA-N. The full InChI is InChI=1S/C8H12F2INO3/c9-8(10)5-12(7(14)2-4-13)3-1-6(8)15-11/h6,13H,1-5H2/t6-/m0/s1.
What are the key properties of [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite?
[(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite has a molecular weight of 335.09 g/mol, XLogP of 0.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4S)-3,3-difluoro-1-(3-hydroxypropanoyl)piperidin-4-yl] hypoiodite is sourced from PubChem (CID 121246761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).