About [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite
[(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite (PubChem CID 121246999) has the molecular formula C10H17FIN3O3
and a molecular weight of 373.17 g/mol. Its IUPAC name is [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite.
Molecular Properties
| Compound Name | [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite |
| PubChem CID | 121246999 |
| Molecular Formula | C10H17FIN3O3 |
| Molecular Weight | 373.17 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite |
| SMILES | CNC(CCN=O)C(=O)N1CC[C@H](OI)[C@H](F)C1 |
| InChI | InChI=1S/C10H17FIN3O3/c1-13-8(2-4-14-17)10(16)15-5-3-9(18-12)7(11)6-15/h7-9,13H,2-6H2,1H3/t7-,8?,9+/m1/s1 |
| InChIKey | XRMLONCHTZIYRP-NBXIYJJMSA-N |
| XLogP | 1.04 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.17 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite?
The IUPAC name of [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite (CID 121246999) is [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite.
What is the SMILES notation for [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite?
The canonical SMILES for [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite is CNC(CCN=O)C(=O)N1CC[C@H](OI)[C@H](F)C1.
What is the InChIKey of [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite?
The InChIKey is XRMLONCHTZIYRP-NBXIYJJMSA-N. The full InChI is InChI=1S/C10H17FIN3O3/c1-13-8(2-4-14-17)10(16)15-5-3-9(18-12)7(11)6-15/h7-9,13H,2-6H2,1H3/t7-,8?,9+/m1/s1.
What are the key properties of [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite?
[(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite has a molecular weight of 373.17 g/mol, XLogP of 1.04, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3-fluoro-1-[2-(methylamino)-4-nitrosobutanoyl]piperidin-4-yl] hypoiodite is sourced from PubChem (CID 121246999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).