C31H34F2N8O4 — CID 121247076
2-[(4S,5S)-3,3-difluoro-1-(2-hydroxyacetyl)-5-methylpiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 121247076) has the molecular formula C31H34F2N8O4 and a molecular weight of 620.66 g/mol. Its IUPAC name is 2-[(4S,5S)-3,3-difluoro-1-(2-hydroxyacetyl)-5-methylpiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(4S,5S)-3,3-difluoro-1-(2-hydroxyacetyl)-5-methylpiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 121247076 |
| Molecular Formula | C31H34F2N8O4 |
| Molecular Weight | 620.66 g/mol |
| Exact Mass | 620.27 |
| IUPAC Name | 2-[(4S,5S)-3,3-difluoro-1-(2-hydroxyacetyl)-5-methylpiperidin-4-yl]oxy-5-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | C[C@H]1CN(C(=O)CO)CC(F)(F)[C@H]1Oc1ccc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)cc1C#N |
| InChI | InChI=1S/C31H34F2N8O4/c1-20-14-41(27(43)15-42)18-31(32,33)28(20)45-26-7-2-21(12-22(26)13-34)29-35-19-36-30(38-29)37-23-3-5-24(6-4-23)39-8-10-40(11-9-39)25-16-44-17-25/h2-7,12,19-20,25,28,42H,8-11,14-18H2,1H3,(H,35,36,37,38)/t20-,28-/m0/s1 |
| InChIKey | AUBYDIOIZLCJCZ-MMTVBGGISA-N |
| XLogP | 2.53 |
| TPSA | 139.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.66 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|