C20H20F2N2O3 — CID 121247383
2-[(3aS,6aR)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone (PubChem CID 121247383) has the molecular formula C20H20F2N2O3 and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone.
| Compound Name | 2-[(3aS,6aR)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 121247383 |
| Molecular Formula | C20H20F2N2O3 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[(3aS,6aR)-5-[(2-fluoro-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone |
| SMILES | O=C(CN1C[C@H]2CC(Oc3cccnc3F)C[C@H]2C1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C20H20F2N2O3/c21-16-8-12(3-4-17(16)25)18(26)11-24-9-13-6-15(7-14(13)10-24)27-19-2-1-5-23-20(19)22/h1-5,8,13-15,25H,6-7,9-11H2/t13-,14+,15? |
| InChIKey | LXTIZBVRJZXQKZ-YIONKMFJSA-N |
| XLogP | 3.04 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|