C21H25FN2O4 — CID 121247395
6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-2-fluoropyridin-3-ol (PubChem CID 121247395) has the molecular formula C21H25FN2O4 and a molecular weight of 388.44 g/mol. Its IUPAC name is 6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-2-fluoropyridin-3-ol.
| Compound Name | 6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-2-fluoropyridin-3-ol |
|---|---|
| PubChem CID | 121247395 |
| Molecular Formula | C21H25FN2O4 |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 6-[2-[(3aS,6aR)-5-(4-methoxyphenoxy)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-hydroxyethyl]-2-fluoropyridin-3-ol |
| SMILES | COc1ccc(OC2C[C@@H]3CN(CC(O)c4ccc(O)c(F)n4)C[C@@H]3C2)cc1 |
| InChI | InChI=1S/C21H25FN2O4/c1-27-15-2-4-16(5-3-15)28-17-8-13-10-24(11-14(13)9-17)12-20(26)18-6-7-19(25)21(22)23-18/h2-7,13-14,17,20,25-26H,8-12H2,1H3/t13-,14+,17?,20? |
| InChIKey | HSFICAKDLNBJOD-PVPYECKJSA-N |
| XLogP | 2.76 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|