C20H21FN2O3 — CID 121247433
2-[(3aS,6aR)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone (PubChem CID 121247433) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone.
| Compound Name | 2-[(3aS,6aR)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 121247433 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[(3aS,6aR)-5-pyridin-3-yloxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(3-fluoro-4-hydroxyphenyl)ethanone |
| SMILES | O=C(CN1C[C@H]2CC(Oc3cccnc3)C[C@H]2C1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C20H21FN2O3/c21-18-8-13(3-4-19(18)24)20(25)12-23-10-14-6-17(7-15(14)11-23)26-16-2-1-5-22-9-16/h1-5,8-9,14-15,17,24H,6-7,10-12H2/t14-,15+,17? |
| InChIKey | RUCKLXUAYXTBEB-FKEKPDDDSA-N |
| XLogP | 2.90 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |