C18H30O7 — CID 121247498
[(2R,3S,4R)-3,4-bis(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate (PubChem CID 121247498) has the molecular formula C18H30O7 and a molecular weight of 358.43 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate.
| Compound Name | [(2R,3S,4R)-3,4-bis(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 121247498 |
| Molecular Formula | C18H30O7 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis(2-methylpropanoyloxy)oxan-2-yl]methyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H]1OCC[C@@H](OC(=O)C(C)C)[C@@H]1OC(=O)C(C)C |
| InChI | InChI=1S/C18H30O7/c1-10(2)16(19)23-9-14-15(25-18(21)12(5)6)13(7-8-22-14)24-17(20)11(3)4/h10-15H,7-9H2,1-6H3/t13-,14-,15+/m1/s1 |
| InChIKey | XWWQNWKFVBFJEK-KFWWJZLASA-N |
| XLogP | 2.11 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|