C21H24N2O3 — CID 121247688
2-[(3aS,6aR)-5-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone (PubChem CID 121247688) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-[(3aS,6aR)-5-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone.
| Compound Name | 2-[(3aS,6aR)-5-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone |
|---|---|
| PubChem CID | 121247688 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-[(3aS,6aR)-5-[(2-methyl-3-pyridinyl)oxy]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-2-yl]-1-(4-hydroxyphenyl)ethanone |
| SMILES | Cc1ncccc1OC1C[C@@H]2CN(CC(=O)c3ccc(O)cc3)C[C@@H]2C1 |
| InChI | InChI=1S/C21H24N2O3/c1-14-21(3-2-8-22-14)26-19-9-16-11-23(12-17(16)10-19)13-20(25)15-4-6-18(24)7-5-15/h2-8,16-17,19,24H,9-13H2,1H3/t16-,17+,19? |
| InChIKey | ZVORKMFCMKAFSO-JJTKIYQPSA-N |
| XLogP | 3.07 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |