C50H90N4O8 — CID 121247845
tetrakis[2,6-di(propan-2-yl)piperidin-4-yl] ethane-1,1,1,2-tetracarboxylate (PubChem CID 121247845) has the molecular formula C50H90N4O8 and a molecular weight of 875.29 g/mol. Its IUPAC name is tetrakis[2,6-di(propan-2-yl)piperidin-4-yl] ethane-1,1,1,2-tetracarboxylate.
| Compound Name | tetrakis[2,6-di(propan-2-yl)piperidin-4-yl] ethane-1,1,1,2-tetracarboxylate |
|---|---|
| PubChem CID | 121247845 |
| Molecular Formula | C50H90N4O8 |
| Molecular Weight | 875.29 g/mol |
| Exact Mass | 874.68 |
| IUPAC Name | tetrakis[2,6-di(propan-2-yl)piperidin-4-yl] ethane-1,1,1,2-tetracarboxylate |
| SMILES | CC(C)C1CC(OC(=O)CC(C(=O)OC2CC(C(C)C)NC(C(C)C)C2)(C(=O)OC2CC(C(C)C)NC(C(C)C)C2)C(=O)OC2CC(C(C)C)NC(C(C)C)C2)CC(C(C)C)N1 |
| InChI | InChI=1S/C50H90N4O8/c1-26(2)38-17-34(18-39(51-38)27(3)4)59-46(55)25-50(47(56)60-35-19-40(28(5)6)52-41(20-35)29(7)8,48(57)61-36-21-42(30(9)10)53-43(22-36)31(11)12)49(58)62-37-23-44(32(13)14)54-45(24-37)33(15)16/h26-45,51-54H,17-25H2,1-16H3 |
| InChIKey | PEQPHOWGZSSQOC-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.29 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|