C38H69N3O6 — CID 121247868
tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) ethane-1,1,2-tricarboxylate (PubChem CID 121247868) has the molecular formula C38H69N3O6 and a molecular weight of 663.99 g/mol. Its IUPAC name is tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) ethane-1,1,2-tricarboxylate.
| Compound Name | tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 121247868 |
| Molecular Formula | C38H69N3O6 |
| Molecular Weight | 663.99 g/mol |
| Exact Mass | 663.52 |
| IUPAC Name | tris(2,2,6-trimethyl-6-propan-2-ylpiperidin-4-yl) ethane-1,1,2-tricarboxylate |
| SMILES | CC(C)C1(C)CC(OC(=O)CC(C(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)C(=O)OC2CC(C)(C)NC(C)(C(C)C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C38H69N3O6/c1-23(2)36(13)20-26(17-33(7,8)39-36)45-30(42)16-29(31(43)46-27-18-34(9,10)40-37(14,21-27)24(3)4)32(44)47-28-19-35(11,12)41-38(15,22-28)25(5)6/h23-29,39-41H,16-22H2,1-15H3 |
| InChIKey | PSOZHTJRJHNZIR-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.99 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|