About 6-(triazol-1-yl)-1,3-benzothiazole
6-(triazol-1-yl)-1,3-benzothiazole (PubChem CID 121247896) has the molecular formula C9H6N4S
and a molecular weight of 202.24 g/mol. Its IUPAC name is 6-(triazol-1-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-(triazol-1-yl)-1,3-benzothiazole |
| PubChem CID | 121247896 |
| Molecular Formula | C9H6N4S |
| Molecular Weight | 202.24 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 6-(triazol-1-yl)-1,3-benzothiazole |
| SMILES | c1cn(-c2ccc3ncsc3c2)nn1 |
| InChI | InChI=1S/C9H6N4S/c1-2-8-9(14-6-10-8)5-7(1)13-4-3-11-12-13/h1-6H |
| InChIKey | LJURKIMNZYNHGJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(triazol-1-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(triazol-1-yl)-1,3-benzothiazole?
The IUPAC name of 6-(triazol-1-yl)-1,3-benzothiazole (CID 121247896) is 6-(triazol-1-yl)-1,3-benzothiazole.
What is the SMILES notation for 6-(triazol-1-yl)-1,3-benzothiazole?
The canonical SMILES for 6-(triazol-1-yl)-1,3-benzothiazole is c1cn(-c2ccc3ncsc3c2)nn1.
What is the InChIKey of 6-(triazol-1-yl)-1,3-benzothiazole?
The InChIKey is LJURKIMNZYNHGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4S/c1-2-8-9(14-6-10-8)5-7(1)13-4-3-11-12-13/h1-6H.
What are the key properties of 6-(triazol-1-yl)-1,3-benzothiazole?
6-(triazol-1-yl)-1,3-benzothiazole has a molecular weight of 202.24 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(triazol-1-yl)-1,3-benzothiazole is sourced from PubChem (CID 121247896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).