C43H85N3 — CID 121247903
4-[1,10-bis[2,6-di(propan-2-yl)piperidin-4-yl]decyl]-2,6-di(propan-2-yl)piperidine (PubChem CID 121247903) has the molecular formula C43H85N3 and a molecular weight of 644.17 g/mol. Its IUPAC name is 4-[1,10-bis[2,6-di(propan-2-yl)piperidin-4-yl]decyl]-2,6-di(propan-2-yl)piperidine.
| Compound Name | 4-[1,10-bis[2,6-di(propan-2-yl)piperidin-4-yl]decyl]-2,6-di(propan-2-yl)piperidine |
|---|---|
| PubChem CID | 121247903 |
| Molecular Formula | C43H85N3 |
| Molecular Weight | 644.17 g/mol |
| Exact Mass | 643.67 |
| IUPAC Name | 4-[1,10-bis[2,6-di(propan-2-yl)piperidin-4-yl]decyl]-2,6-di(propan-2-yl)piperidine |
| SMILES | CC(C)C1CC(CCCCCCCCCC(C2CC(C(C)C)NC(C(C)C)C2)C2CC(C(C)C)NC(C(C)C)C2)CC(C(C)C)N1 |
| InChI | InChI=1S/C43H85N3/c1-28(2)38-22-34(23-39(44-38)29(3)4)20-18-16-14-13-15-17-19-21-37(35-24-40(30(5)6)45-41(25-35)31(7)8)36-26-42(32(9)10)46-43(27-36)33(11)12/h28-46H,13-27H2,1-12H3 |
| InChIKey | VCINCUXNVSGLKP-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.17 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|