C28H27ClFN5O4 — CID 121247976
2-[15-chloro-10-(fluoromethyl)-4,8-dioxo-5,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-methoxy-N-(2-methylindazol-5-yl)butanamide (PubChem CID 121247976) has the molecular formula C28H27ClFN5O4 and a molecular weight of 552.01 g/mol. Its IUPAC name is 2-[15-chloro-10-(fluoromethyl)-4,8-dioxo-5,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-methoxy-N-(2-methylindazol-5-yl)butanamide.
| Compound Name | 2-[15-chloro-10-(fluoromethyl)-4,8-dioxo-5,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-methoxy-N-(2-methylindazol-5-yl)butanamide |
|---|---|
| PubChem CID | 121247976 |
| Molecular Formula | C28H27ClFN5O4 |
| Molecular Weight | 552.01 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 2-[15-chloro-10-(fluoromethyl)-4,8-dioxo-5,9-diazatricyclo[10.4.0.02,7]hexadeca-1(12),2,6,13,15-pentaen-5-yl]-4-methoxy-N-(2-methylindazol-5-yl)butanamide |
| SMILES | COCCC(C(=O)Nc1ccc2nn(C)cc2c1)n1cc2c(cc1=O)-c1cc(Cl)ccc1CC(CF)NC2=O |
| InChI | InChI=1S/C28H27ClFN5O4/c1-34-14-17-10-19(5-6-24(17)33-34)31-28(38)25(7-8-39-2)35-15-23-22(12-26(35)36)21-11-18(29)4-3-16(21)9-20(13-30)32-27(23)37/h3-6,10-12,14-15,20,25H,7-9,13H2,1-2H3,(H,31,38)(H,32,37) |
| InChIKey | WTECJQOPSGZRRS-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |