About 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile
2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile (PubChem CID 121248198) has the molecular formula C19H12ClN3O4
and a molecular weight of 381.78 g/mol. Its IUPAC name is 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile.
Molecular Properties
| Compound Name | 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile |
| PubChem CID | 121248198 |
| Molecular Formula | C19H12ClN3O4 |
| Molecular Weight | 381.78 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile |
| SMILES | CC1(COc2ccc(C#N)cc2)OC(=O)N(c2ccc(C#N)c(Cl)c2)C1=O |
| InChI | InChI=1S/C19H12ClN3O4/c1-19(11-26-15-6-2-12(9-21)3-7-15)17(24)23(18(25)27-19)14-5-4-13(10-22)16(20)8-14/h2-8H,11H2,1H3 |
| InChIKey | FEMFPTFYCPWOEE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 103.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile?
The IUPAC name of 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile (CID 121248198) is 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile.
What is the SMILES notation for 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile?
The canonical SMILES for 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile is CC1(COc2ccc(C#N)cc2)OC(=O)N(c2ccc(C#N)c(Cl)c2)C1=O.
What is the InChIKey of 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile?
The InChIKey is FEMFPTFYCPWOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12ClN3O4/c1-19(11-26-15-6-2-12(9-21)3-7-15)17(24)23(18(25)27-19)14-5-4-13(10-22)16(20)8-14/h2-8H,11H2,1H3.
What are the key properties of 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile?
2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile has a molecular weight of 381.78 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[5-[(4-cyanophenoxy)methyl]-5-methyl-2,4-dioxo-1,3-oxazolidin-3-yl]benzonitrile is sourced from PubChem (CID 121248198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).