About 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one
5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one (PubChem CID 121248205) has the molecular formula C24H26N4O2
and a molecular weight of 402.50 g/mol. Its IUPAC name is 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one.
Molecular Properties
| Compound Name | 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one |
| PubChem CID | 121248205 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one |
| SMILES | CC(C)[C@H](N)[C@H](Oc1ccc2c(cnn2-c2ccc(=O)n(C)c2)c1)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O2/c1-16(2)23(25)24(17-7-5-4-6-8-17)30-20-10-11-21-18(13-20)14-26-28(21)19-9-12-22(29)27(3)15-19/h4-16,23-24H,25H2,1-3H3/t23-,24+/m0/s1 |
| InChIKey | CLNDHBCAURHDQF-BJKOFHAPSA-N |
| XLogP | 3.83 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one?
The IUPAC name of 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one (CID 121248205) is 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one.
What is the SMILES notation for 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one?
The canonical SMILES for 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one is CC(C)[C@H](N)[C@H](Oc1ccc2c(cnn2-c2ccc(=O)n(C)c2)c1)c1ccccc1.
What is the InChIKey of 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one?
The InChIKey is CLNDHBCAURHDQF-BJKOFHAPSA-N. The full InChI is InChI=1S/C24H26N4O2/c1-16(2)23(25)24(17-7-5-4-6-8-17)30-20-10-11-21-18(13-20)14-26-28(21)19-9-12-22(29)27(3)15-19/h4-16,23-24H,25H2,1-3H3/t23-,24+/m0/s1.
What are the key properties of 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one?
5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one has a molecular weight of 402.50 g/mol, XLogP of 3.83, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-[(1R,2S)-2-amino-3-methyl-1-phenylbutoxy]indazol-1-yl]-1-methylpyridin-2-one is sourced from PubChem (CID 121248205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).