C31H31N9O3 — CID 121249103
N-[2-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]ethyl]pyridine-3-carboxamide (PubChem CID 121249103) has the molecular formula C31H31N9O3 and a molecular weight of 577.65 g/mol. Its IUPAC name is N-[2-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121249103 |
| Molecular Formula | C31H31N9O3 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | N-[2-[2-cyano-4-[4-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,3,5-triazin-2-yl]phenoxy]ethyl]pyridine-3-carboxamide |
| SMILES | N#Cc1cc(-c2ncnc(Nc3ccc(N4CCN(C5COC5)CC4)cc3)n2)ccc1OCCNC(=O)c1cccnc1 |
| InChI | InChI=1S/C31H31N9O3/c32-17-24-16-22(3-8-28(24)43-15-10-34-30(41)23-2-1-9-33-18-23)29-35-21-36-31(38-29)37-25-4-6-26(7-5-25)39-11-13-40(14-12-39)27-19-42-20-27/h1-9,16,18,21,27H,10-15,19-20H2,(H,34,41)(H,35,36,37,38) |
| InChIKey | OBWLDNKSQSVPND-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 141.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|