About [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid
[(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid (PubChem CID 121249230) has the molecular formula C18H23BrN2O3
and a molecular weight of 395.30 g/mol. Its IUPAC name is [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid.
Molecular Properties
| Compound Name | [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid |
| PubChem CID | 121249230 |
| Molecular Formula | C18H23BrN2O3 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@@H]1CCCC[C@@H]1Oc1ccc(Br)cc1C#N |
| InChI | InChI=1S/C18H23BrN2O3/c1-18(2,3)21(17(22)23)14-6-4-5-7-16(14)24-15-9-8-13(19)10-12(15)11-20/h8-10,14,16H,4-7H2,1-3H3,(H,22,23)/t14-,16+/m1/s1 |
| InChIKey | RPHFSLSZAIWQQR-ZBFHGGJFSA-N |
| XLogP | 4.79 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid?
The IUPAC name of [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid (CID 121249230) is [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid.
What is the SMILES notation for [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid?
The canonical SMILES for [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid is CC(C)(C)N(C(=O)O)[C@@H]1CCCC[C@@H]1Oc1ccc(Br)cc1C#N.
What is the InChIKey of [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid?
The InChIKey is RPHFSLSZAIWQQR-ZBFHGGJFSA-N. The full InChI is InChI=1S/C18H23BrN2O3/c1-18(2,3)21(17(22)23)14-6-4-5-7-16(14)24-15-9-8-13(19)10-12(15)11-20/h8-10,14,16H,4-7H2,1-3H3,(H,22,23)/t14-,16+/m1/s1.
What are the key properties of [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid?
[(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid has a molecular weight of 395.30 g/mol, XLogP of 4.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-(4-bromo-2-cyanophenoxy)cyclohexyl]-tert-butylcarbamic acid is sourced from PubChem (CID 121249230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).