C26H21Cl2F3N4O7 — CID 121249275
azetidin-3-yl 2-(2,4-dichlorophenyl)-5-methyl-1-[4-(4-nitrooxybut-1-ynyl)phenyl]imidazole-4-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 121249275) has the molecular formula C26H21Cl2F3N4O7 and a molecular weight of 629.38 g/mol. Its IUPAC name is azetidin-3-yl 2-(2,4-dichlorophenyl)-5-methyl-1-[4-(4-nitrooxybut-1-ynyl)phenyl]imidazole-4-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | azetidin-3-yl 2-(2,4-dichlorophenyl)-5-methyl-1-[4-(4-nitrooxybut-1-ynyl)phenyl]imidazole-4-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 121249275 |
| Molecular Formula | C26H21Cl2F3N4O7 |
| Molecular Weight | 629.38 g/mol |
| Exact Mass | 628.07 |
| IUPAC Name | azetidin-3-yl 2-(2,4-dichlorophenyl)-5-methyl-1-[4-(4-nitrooxybut-1-ynyl)phenyl]imidazole-4-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | Cc1c(C(=O)OC2CNC2)nc(-c2ccc(Cl)cc2Cl)n1-c1ccc(C#CCCO[N+](=O)[O-])cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C24H20Cl2N4O5.C2HF3O2/c1-15-22(24(31)35-19-13-27-14-19)28-23(20-10-7-17(25)12-21(20)26)29(15)18-8-5-16(6-9-18)4-2-3-11-34-30(32)33;3-2(4,5)1(6)7/h5-10,12,19,27H,3,11,13-14H2,1H3;(H,6,7) |
| InChIKey | MTHKCPMQQLOPNG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 145.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|