C29H25F6N5O4 — CID 121249410
4-[3-[(2R,4R)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4-[2-[2-(trifluoromethyl)pyrimidin-4-yl]propan-2-ylamino]pyrrolidin-2-yl]phenyl]but-3-ynyl nitrate (PubChem CID 121249410) has the molecular formula C29H25F6N5O4 and a molecular weight of 621.54 g/mol. Its IUPAC name is 4-[3-[(2R,4R)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4-[2-[2-(trifluoromethyl)pyrimidin-4-yl]propan-2-ylamino]pyrrolidin-2-yl]phenyl]but-3-ynyl nitrate.
| Compound Name | 4-[3-[(2R,4R)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4-[2-[2-(trifluoromethyl)pyrimidin-4-yl]propan-2-ylamino]pyrrolidin-2-yl]phenyl]but-3-ynyl nitrate |
|---|---|
| PubChem CID | 121249410 |
| Molecular Formula | C29H25F6N5O4 |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 621.18 |
| IUPAC Name | 4-[3-[(2R,4R)-5-oxo-1-[4-(trifluoromethyl)phenyl]-4-[2-[2-(trifluoromethyl)pyrimidin-4-yl]propan-2-ylamino]pyrrolidin-2-yl]phenyl]but-3-ynyl nitrate |
| SMILES | CC(C)(N[C@@H]1C[C@H](c2cccc(C#CCCO[N+](=O)[O-])c2)N(c2ccc(C(F)(F)F)cc2)C1=O)c1ccnc(C(F)(F)F)n1 |
| InChI | InChI=1S/C29H25F6N5O4/c1-27(2,24-13-14-36-26(37-24)29(33,34)35)38-22-17-23(19-8-5-7-18(16-19)6-3-4-15-44-40(42)43)39(25(22)41)21-11-9-20(10-12-21)28(30,31)32/h5,7-14,16,22-23,38H,4,15,17H2,1-2H3/t22-,23-/m1/s1 |
| InChIKey | XFKOYAZPXVVCEP-DHIUTWEWSA-N |
| XLogP | 5.84 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|