C22H25N5O4 — CID 121249635
methyl 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]benzoate (PubChem CID 121249635) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is methyl 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]benzoate.
| Compound Name | methyl 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]benzoate |
|---|---|
| PubChem CID | 121249635 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | methyl 3-[4-[(2-methylpropan-2-yl)oxycarbonylamino]-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraen-11-yl]benzoate |
| SMILES | COC(=O)c1cccc(N2CCc3c(cnc4cc(NC(=O)OC(C)(C)C)nn34)C2)c1 |
| InChI | InChI=1S/C22H25N5O4/c1-22(2,3)31-21(29)24-18-11-19-23-12-15-13-26(9-8-17(15)27(19)25-18)16-7-5-6-14(10-16)20(28)30-4/h5-7,10-12H,8-9,13H2,1-4H3,(H,24,25,29) |
| InChIKey | OYJDQJYFTYJHFX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |