C10H11N3 — CID 121249668
2,7,11-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene (PubChem CID 121249668) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2,7,11-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene.
| Compound Name | 2,7,11-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 121249668 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 2,7,11-triazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
| SMILES | c1cc2ncc3c(n2c1)CCNC3 |
| InChI | InChI=1S/C10H11N3/c1-2-10-12-7-8-6-11-4-3-9(8)13(10)5-1/h1-2,5,7,11H,3-4,6H2 |
| InChIKey | ILTPBBJOEDBVRD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |