C25H26FN7O2 — CID 121249744
3-tert-butyl-N-[[2-fluoro-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 121249744) has the molecular formula C25H26FN7O2 and a molecular weight of 475.53 g/mol. Its IUPAC name is 3-tert-butyl-N-[[2-fluoro-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N-[[2-fluoro-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 121249744 |
| Molecular Formula | C25H26FN7O2 |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 3-tert-butyl-N-[[2-fluoro-4-[2-(1,2,3,6-tetrahydropyridin-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]phenyl]methyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1noc(C(=O)NCc2ccc(-c3ccnc4nc(C5=CCNCC5)[nH]c34)cc2F)n1 |
| InChI | InChI=1S/C25H26FN7O2/c1-25(2,3)24-32-23(35-33-24)22(34)29-13-16-5-4-15(12-18(16)26)17-8-11-28-21-19(17)30-20(31-21)14-6-9-27-10-7-14/h4-6,8,11-12,27H,7,9-10,13H2,1-3H3,(H,29,34)(H,28,30,31) |
| InChIKey | DLWPSCPZNQLAHR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |