C12H10N4O2S — CID 121249857
6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 121249857) has the molecular formula C12H10N4O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is 6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 121249857 |
| Molecular Formula | C12H10N4O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 6-(benzenesulfonyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Nc1nc2ccc(S(=O)(=O)c3ccccc3)cn2n1 |
| InChI | InChI=1S/C12H10N4O2S/c13-12-14-11-7-6-10(8-16(11)15-12)19(17,18)9-4-2-1-3-5-9/h1-8H,(H2,13,15) |
| InChIKey | ZVZVHOHHGORYAH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |