C32H35N7O4 — CID 121249921
5-tert-butyl-N-[3-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-(hydroxymethyl)phenyl]-1,2,4-oxadiazole-3-carboxamide (PubChem CID 121249921) has the molecular formula C32H35N7O4 and a molecular weight of 581.68 g/mol. Its IUPAC name is 5-tert-butyl-N-[3-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-(hydroxymethyl)phenyl]-1,2,4-oxadiazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-[3-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-(hydroxymethyl)phenyl]-1,2,4-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 121249921 |
| Molecular Formula | C32H35N7O4 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.28 |
| IUPAC Name | 5-tert-butyl-N-[3-[2-[4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]phenyl]-1H-imidazo[4,5-b]pyridin-7-yl]-2-(hydroxymethyl)phenyl]-1,2,4-oxadiazole-3-carboxamide |
| SMILES | C[C@@H]1CN(c2ccc(-c3nc4nccc(-c5cccc(NC(=O)c6noc(C(C)(C)C)n6)c5CO)c4[nH]3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C32H35N7O4/c1-18-15-39(16-19(2)42-18)21-11-9-20(10-12-21)27-35-26-23(13-14-33-28(26)36-27)22-7-6-8-25(24(22)17-40)34-30(41)29-37-31(43-38-29)32(3,4)5/h6-14,18-19,40H,15-17H2,1-5H3,(H,34,41)(H,33,35,36)/t18-,19+ |
| InChIKey | FGYNFVQBUROCBO-KDURUIRLSA-N |
| XLogP | 5.33 |
| TPSA | 142.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|