C28H34N4O3S — CID 121250320
(3R)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide (PubChem CID 121250320) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is (3R)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 121250320 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | (3R)-N-[6-amino-1-(1,3-benzothiazol-2-yl)-1-oxohexan-2-yl]-1-(3-phenylpropanoyl)piperidine-3-carboxamide |
| SMILES | NCCCCC(NC(=O)[C@@H]1CCCN(C(=O)CCc2ccccc2)C1)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C28H34N4O3S/c29-17-7-6-13-23(26(34)28-31-22-12-4-5-14-24(22)36-28)30-27(35)21-11-8-18-32(19-21)25(33)16-15-20-9-2-1-3-10-20/h1-5,9-10,12,14,21,23H,6-8,11,13,15-19,29H2,(H,30,35)/t21-,23?/m1/s1 |
| InChIKey | LZIQKKGKSQRLJR-FKHAVUOCSA-N |
| XLogP | 3.96 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|