About (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium
(2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium (PubChem CID 121250367) has the molecular formula C9H13Cl2O6P2S+
and a molecular weight of 382.12 g/mol. Its IUPAC name is (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium.
Molecular Properties
| Compound Name | (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium |
| PubChem CID | 121250367 |
| Molecular Formula | C9H13Cl2O6P2S+ |
| Molecular Weight | 382.12 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium |
| SMILES | COP(=S)(OC)Oc1c(Cl)cc(C)cc1Cl.O=[P+](O)O |
| InChI | InChI=1S/C9H11Cl2O3PS.HO3P/c1-6-4-7(10)9(8(11)5-6)14-15(16,12-2)13-3;1-4(2)3/h4-5H,1-3H3;(H-,1,2,3)/p+1 |
| InChIKey | QINPOXFAGBVEKU-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium?
The IUPAC name of (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium (CID 121250367) is (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium.
What is the SMILES notation for (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium?
The canonical SMILES for (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium is COP(=S)(OC)Oc1c(Cl)cc(C)cc1Cl.O=[P+](O)O.
What is the InChIKey of (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium?
The InChIKey is QINPOXFAGBVEKU-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H11Cl2O3PS.HO3P/c1-6-4-7(10)9(8(11)5-6)14-15(16,12-2)13-3;1-4(2)3/h4-5H,1-3H3;(H-,1,2,3)/p+1.
What are the key properties of (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium?
(2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium has a molecular weight of 382.12 g/mol, XLogP of 3.83, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-dichloro-4-methylphenoxy)-dimethoxy-sulfanylidene-λ5-phosphane;dihydroxy(oxo)phosphanium is sourced from PubChem (CID 121250367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).