C32H45N5O3S — CID 121251470
N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide (PubChem CID 121251470) has the molecular formula C32H45N5O3S and a molecular weight of 579.81 g/mol. Its IUPAC name is N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide.
| Compound Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 121251470 |
| Molecular Formula | C32H45N5O3S |
| Molecular Weight | 579.81 g/mol |
| Exact Mass | 579.32 |
| IUPAC Name | N-[(6-amino-2-pyridinyl)sulfonyl]-6-tert-butyl-5-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CN(c2nc(C(C)(C)C)c(C3=CC4CCC3(C)C4(C)C)cc2C(=O)NS(=O)(=O)c2cccc(N)n2)C(C)(C)C1 |
| InChI | InChI=1S/C32H45N5O3S/c1-19-17-30(5,6)37(18-19)27-22(28(38)36-41(39,40)25-12-10-11-24(33)34-25)16-21(26(35-27)29(2,3)4)23-15-20-13-14-32(23,9)31(20,7)8/h10-12,15-16,19-20H,13-14,17-18H2,1-9H3,(H2,33,34)(H,36,38) |
| InChIKey | BZIQYDPTPNFIEL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.81 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |